Difference between revisions of "CPD-13205"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-seryl-SEC-tRNAs == * common-name: ** an l-seryl-[trnasec] == Reaction(s) known to consume the compound == * RXN-10038 == Reaction(s...")
(Created page with "Category:metabolite == Metabolite CPD-13559 == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-pqmkyfcfsa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-seryl-SEC-tRNAs ==
+
== Metabolite CPD-13559 ==
 
* common-name:
 
* common-name:
** an l-seryl-[trnasec]
+
** α-d-mannopyranose
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o)c(o)o1)
 +
* inchi-key:
 +
** wqzgkkkjijffok-pqmkyfcfsa-n
 +
* molecular-weight:
 +
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10038]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10038]]
+
* [[3.2.1.24-RXN]]
* [[RXN0-2161]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-seryl-[trnasec]}}
+
{{#set: common-name=α-d-mannopyranose}}
 +
{{#set: inchi-key=inchikey=wqzgkkkjijffok-pqmkyfcfsa-n}}
 +
{{#set: molecular-weight=180.157}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-13559

  • common-name:
    • α-d-mannopyranose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o)o1)
  • inchi-key:
    • wqzgkkkjijffok-pqmkyfcfsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality