Difference between revisions of "CPD-13227"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
(Created page with "Category:metabolite == Metabolite CPD-13227 == * common-name: ** n,n',n''-triacetylchitotriose * smiles: ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19148 ==
+
== Metabolite CPD-13227 ==
 
* common-name:
 
* common-name:
** (5z)-dodecenoyl-coa
+
** n,n',n''-triacetylchitotriose
 
* smiles:
 
* smiles:
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
 
* inchi-key:
 
* inchi-key:
** rcvjzgbrlgutkt-cggpsvllsa-j
+
** wzzvuhwlnmnwlw-mewklcdlsa-n
 
* molecular-weight:
 
* molecular-weight:
** 943.792
+
** 627.598
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17796]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17795]]
+
* [[RXN-12623]]
 +
* [[RXN-12624]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-dodecenoyl-coa}}
+
{{#set: common-name=n,n',n''-triacetylchitotriose}}
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
+
{{#set: inchi-key=inchikey=wzzvuhwlnmnwlw-mewklcdlsa-n}}
{{#set: molecular-weight=943.792}}
+
{{#set: molecular-weight=627.598}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-13227

  • common-name:
    • n,n',n-triacetylchitotriose
  • smiles:
    • cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
  • inchi-key:
    • wzzvuhwlnmnwlw-mewklcdlsa-n
  • molecular-weight:
    • 627.598

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality