Difference between revisions of "CPD-13227"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-L-seryl-Protein == * common-name: ** an n-terminal-l-methionyl-l-seryl-[protein] == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-13227 == * common-name: ** n,n',n''-triacetylchitotriose * smiles: ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13227 == |
* common-name: | * common-name: | ||
− | ** | + | ** n,n',n''-triacetylchitotriose |
+ | * smiles: | ||
+ | ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co))) | ||
+ | * inchi-key: | ||
+ | ** wzzvuhwlnmnwlw-mewklcdlsa-n | ||
+ | * molecular-weight: | ||
+ | ** 627.598 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12623]] | ||
+ | * [[RXN-12624]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n,n',n''-triacetylchitotriose}} |
+ | {{#set: inchi-key=inchikey=wzzvuhwlnmnwlw-mewklcdlsa-n}} | ||
+ | {{#set: molecular-weight=627.598}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-13227
- common-name:
- n,n',n-triacetylchitotriose
- smiles:
- cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
- inchi-key:
- wzzvuhwlnmnwlw-mewklcdlsa-n
- molecular-weight:
- 627.598