Difference between revisions of "CPD-13293"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-L-CITRULLINE == * common-name: ** a [protein]-l-citrulline == Reaction(s) known to consume the compound == == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTEIN-L-CITRULLINE ==
+
== Metabolite CPD-15301 ==
 
* common-name:
 
* common-name:
** a [protein]-l-citrulline
+
** caldariellaquinol
 +
* smiles:
 +
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
 +
* inchi-key:
 +
** uvcqokdzgiahdg-uhfffaoysa-n
 +
* molecular-weight:
 +
** 633.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
+
* [[RXN-15378]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-citrulline}}
+
{{#set: common-name=caldariellaquinol}}
 +
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
 +
{{#set: molecular-weight=633.085}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-15301

  • common-name:
    • caldariellaquinol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
  • inchi-key:
    • uvcqokdzgiahdg-uhfffaoysa-n
  • molecular-weight:
    • 633.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality