Difference between revisions of "CPD-13375"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-578 == * common-name: ** urea-1-carboxylate * smiles: ** c(n)(nc([o-])=o)=o * inchi-key: ** avwrkzwqtyikiy-uhfffaoysa-m * molecular-w...")
(Created page with "Category:metabolite == Metabolite CPD-13375 == * common-name: ** xxxg xyloglucan oligosaccharide * smiles: ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-578 ==
+
== Metabolite CPD-13375 ==
 
* common-name:
 
* common-name:
** urea-1-carboxylate
+
** xxxg xyloglucan oligosaccharide
 
* smiles:
 
* smiles:
** c(n)(nc([o-])=o)=o
+
** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
 
* inchi-key:
 
* inchi-key:
** avwrkzwqtyikiy-uhfffaoysa-m
+
** pzupagrihcrvkn-sphbqonksa-n
 
* molecular-weight:
 
* molecular-weight:
** 103.057
+
** 1062.931
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALLOPHANATE-HYDROLASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12398]]
 +
* [[RXN-12399]]
 +
* [[RXN-12400]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=urea-1-carboxylate}}
+
{{#set: common-name=xxxg xyloglucan oligosaccharide}}
{{#set: inchi-key=inchikey=avwrkzwqtyikiy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=pzupagrihcrvkn-sphbqonksa-n}}
{{#set: molecular-weight=103.057}}
+
{{#set: molecular-weight=1062.931}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-13375

  • common-name:
    • xxxg xyloglucan oligosaccharide
  • smiles:
    • c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
  • inchi-key:
    • pzupagrihcrvkn-sphbqonksa-n
  • molecular-weight:
    • 1062.931

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality