Difference between revisions of "CPD-13375"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10627 == * transcription-direction: ** positive * right-end-position: ** 92463 * left-end-position: ** 86041 * centisome-position: ** 22.226097...") |
(Created page with "Category:metabolite == Metabolite CPD-13375 == * common-name: ** xxxg xyloglucan oligosaccharide * smiles: ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13375 == |
| − | * | + | * common-name: |
| − | ** | + | ** xxxg xyloglucan oligosaccharide |
| − | * | + | * smiles: |
| − | ** | + | ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** pzupagrihcrvkn-sphbqonksa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 1062.931 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-12398]] |
| − | * [[ | + | * [[RXN-12399]] |
| − | * | + | * [[RXN-12400]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | {{#set: common-name=xxxg xyloglucan oligosaccharide}} |
| − | + | {{#set: inchi-key=inchikey=pzupagrihcrvkn-sphbqonksa-n}} | |
| − | + | {{#set: molecular-weight=1062.931}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-13375
- common-name:
- xxxg xyloglucan oligosaccharide
- smiles:
- c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
- inchi-key:
- pzupagrihcrvkn-sphbqonksa-n
- molecular-weight:
- 1062.931
