Difference between revisions of "CPD-13376"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.11.18-RXN 2.7.11.18-RXN] == * direction: ** reversible * common-name: ** myosin light chain kin...")
(Created page with "Category:metabolite == Metabolite CPD-13376 == * common-name: ** xxlg xyloglucan oligosaccharide * smiles: ** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.11.18-RXN 2.7.11.18-RXN] ==
+
== Metabolite CPD-13376 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** myosin light chain kinase
+
** xxlg xyloglucan oligosaccharide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.11.18 ec-2.7.11.18]
+
** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)oc5(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)oc4(c(c(c(c(o4)co)o)o)o)))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-8564]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-8563]][c] '''+''' 1 [[PROTON]][c]
+
** ujniquvnfjifmg-ikgyadnmsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 1225.073
−
* Gene: [[SJ20317]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-12398]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ02243]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=xxlg xyloglucan oligosaccharide}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=ujniquvnfjifmg-ikgyadnmsa-n}}
−
* Gene: [[SJ19226]]
+
{{#set: molecular-weight=1225.073}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ02274]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ11786]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ09863]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ01356]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06685]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ10927]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ19900]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ07187]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ05465]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03150 R03150]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=myosin light chain kinase}}
 
−
{{#set: ec-number=ec-2.7.11.18}}
 
−
{{#set: nb gene associated=12}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-13376

  • common-name:
    • xxlg xyloglucan oligosaccharide
  • smiles:
    • c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)oc5(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)oc4(c(c(c(c(o4)co)o)o)o)))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
  • inchi-key:
    • ujniquvnfjifmg-ikgyadnmsa-n
  • molecular-weight:
    • 1225.073

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13376&oldid=138702"