Difference between revisions of "CPD-13377"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12018 == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) * inchi-key: ** jtejppkmybdemy-uhfffaoysa-...")
(Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12018 ==
+
== Metabolite Charged-TRP-tRNAs ==
 
* common-name:
 
* common-name:
** 5-methoxytryptamine
+
** an l-tryptophanyl-[trnatrp]
* smiles:
 
** coc2(c=cc1(=c(c(ccn)=cn1)c=2))
 
* inchi-key:
 
** jtejppkmybdemy-uhfffaoysa-n
 
* molecular-weight:
 
** 190.244
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11067]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methoxytryptamine}}
+
{{#set: common-name=an l-tryptophanyl-[trnatrp]}}
{{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}}
 
{{#set: molecular-weight=190.244}}
 

Revision as of 08:26, 15 March 2021

Metabolite Charged-TRP-tRNAs

  • common-name:
    • an l-tryptophanyl-[trnatrp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-tryptophanyl-[trnatrp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.