Difference between revisions of "CPD-13377"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06070 == * transcription-direction: ** negative * right-end-position: ** 53495 * left-end-position: ** 4662 * centisome-position: ** 5.532087 =...")
(Created page with "Category:metabolite == Metabolite CPD-13377 == * common-name: ** xlxg xyloglucan oligosaccharide * smiles: ** c8(c(c(c(c(occ7(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06070 ==
+
== Metabolite CPD-13377 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** xlxg xyloglucan oligosaccharide
−
* right-end-position:
+
* smiles:
−
** 53495
+
** c8(c(c(c(c(occ7(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc5(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)o))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
−
* left-end-position:
+
* inchi-key:
−
** 4662
+
** kbczexdvbxuvgr-ikgyadnmsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 5.532087   
+
** 1225.073
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-12399]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=xlxg xyloglucan oligosaccharide}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=kbczexdvbxuvgr-ikgyadnmsa-n}}
−
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
+
{{#set: molecular-weight=1225.073}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5951]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY3O-246]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=53495}}
 
−
{{#set: left-end-position=4662}}
 
−
{{#set: centisome-position=5.532087    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-13377

  • common-name:
    • xlxg xyloglucan oligosaccharide
  • smiles:
    • c8(c(c(c(c(occ7(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc5(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)o))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
  • inchi-key:
    • kbczexdvbxuvgr-ikgyadnmsa-n
  • molecular-weight:
    • 1225.073

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13377&oldid=137447"