Difference between revisions of "CPD-13390"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9910 RXN-9910] == * direction: ** left-to-right * common-name: ** chlorobenzaldehyde dehydrogen...")
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9910 RXN-9910] ==
+
== Metabolite CPD-13390 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** chlorobenzaldehyde dehydrogenase (nad+)
+
** l-methionyl-l-alanine dipeptide
−
** benzaldehyde dehydrogenase (nad+)
+
* smiles:
−
* ec-number:
+
** cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
−
** [http://enzyme.expasy.org/EC/1.2.1.28 ec-1.2.1.28]
+
* inchi-key:
−
== Reaction formula ==
+
** jhkxzylnvjraaj-wdskdsinsa-n
−
* 1 [[CPD-10660]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-3486]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 220.286
−
* Gene: [[SJ06470]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN0-6985]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ06456]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=l-methionyl-l-alanine dipeptide}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=220.286}}
−
* [[PWY-6104]], 3-chlorotoluene degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6104 PWY-6104]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=benzaldehyde dehydrogenase (nad+)|chlorobenzaldehyde dehydrogenase (nad+)}}
 
−
{{#set: ec-number=ec-1.2.1.28}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13390

  • common-name:
    • l-methionyl-l-alanine dipeptide
  • smiles:
    • cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
  • inchi-key:
    • jhkxzylnvjraaj-wdskdsinsa-n
  • molecular-weight:
    • 220.286

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13390&oldid=138962"