Difference between revisions of "CPD-13390"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OAACITtm OAACITtm] == * direction: ** reversible * common-name: ** dicarboxylate/tricarboxylate car...")
 
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=OAACITtm OAACITtm] ==
+
== Metabolite CPD-13390 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** dicarboxylate/tricarboxylate carrier (oaa:cit), mitochondrial
+
** l-methionyl-l-alanine dipeptide
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CIT]][m] '''+''' 1.0 [[OXALACETIC_ACID]][c] '''<=>''' 1.0 [[CIT]][c] '''+''' 1.0 [[OXALACETIC_ACID]][m]
+
** cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ18185]]
+
** jhkxzylnvjraaj-wdskdsinsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 220.286
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN0-6985]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=reversible}}
+
{{#set: common-name=l-methionyl-l-alanine dipeptide}}
−
{{#set: common-name=dicarboxylate/tricarboxylate carrier (oaa:cit), mitochondrial}}
+
{{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=220.286}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13390

  • common-name:
    • l-methionyl-l-alanine dipeptide
  • smiles:
    • cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
  • inchi-key:
    • jhkxzylnvjraaj-wdskdsinsa-n
  • molecular-weight:
    • 220.286

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13390&oldid=138962"