Difference between revisions of "CPD-13390"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19159 == * common-name: ** (s)-3-hydroxy-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)co...")
(Created page with "Category:metabolite == Metabolite 3-oxo-decanoyl-ACPs == * common-name: ** a 3-oxo-decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9528 == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19159 ==
+
== Metabolite 3-oxo-decanoyl-ACPs ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(11z)-octadecenoyl-coa
+
** a 3-oxo-decanoyl-[acp]
* smiles:
 
** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** scdxbwnpjageek-kboaxvdlsa-j
 
* molecular-weight:
 
** 1043.952
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17786]]
+
* [[RXN-9528]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17785]]
+
* [[RXN-9527]]
 +
* [[RXN-9651]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(11z)-octadecenoyl-coa}}
+
{{#set: common-name=a 3-oxo-decanoyl-[acp]}}
{{#set: inchi-key=inchikey=scdxbwnpjageek-kboaxvdlsa-j}}
 
{{#set: molecular-weight=1043.952}}
 

Revision as of 18:57, 14 January 2021

Metabolite 3-oxo-decanoyl-ACPs

  • common-name:
    • a 3-oxo-decanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-decanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.