Difference between revisions of "CPD-13393"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...") |
(Created page with "Category:metabolite == Metabolite CPD-13393 == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=o)c[n+] * inchi-key: ** pfmuccyyaafkth-yfkpbyrvsa-n *...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13393 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-methionine |
* smiles: | * smiles: | ||
| − | ** | + | ** csccc(c(=o)[o-])nc(=o)c[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pfmuccyyaafkth-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 206.259 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6974]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-methionine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=206.259}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-13393
- common-name:
- glycyl-l-methionine
- smiles:
- csccc(c(=o)[o-])nc(=o)c[n+]
- inchi-key:
- pfmuccyyaafkth-yfkpbyrvsa-n
- molecular-weight:
- 206.259
