Difference between revisions of "CPD-13393"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTATHIONE == * common-name: ** glutathione * smiles: ** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** rwsxrvcmgqzwbv-...")
(Created page with "Category:metabolite == Metabolite CPD-13393 == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=o)c[n+] * inchi-key: ** pfmuccyyaafkth-yfkpbyrvsa-n *...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUTATHIONE ==
+
== Metabolite CPD-13393 ==
 
* common-name:
 
* common-name:
** glutathione
+
** glycyl-l-methionine
 
* smiles:
 
* smiles:
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** csccc(c(=o)[o-])nc(=o)c[n+]
 
* inchi-key:
 
* inchi-key:
** rwsxrvcmgqzwbv-wdskdsinsa-m
+
** pfmuccyyaafkth-yfkpbyrvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 306.313
+
** 206.259
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.11.1.12-RXN]]
+
* [[RXN0-6974]]
* [[1.8.4.9-RXN]]
 
* [[1.8.5.1-RXN]]
 
* [[2.3.2.15-RXN]]
 
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 
* [[GLYOXI-RXN]]
 
* [[GSHTRAN-RXN]]
 
* [[GST-RXN]]
 
* [[GTHP]]
 
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
* [[RXN-12618]]
 
* [[RXN-13673]]
 
* [[RXN-15680]]
 
* [[RXN-18092]]
 
* [[RXN-6601]]
 
* [[RXN-9157]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GDR]]
 
* [[GDR_LPAREN_nadp_RPAREN_]]
 
* [[GDR_LPAREN_nadp_RPAREN_h]]
 
* [[GDR_LPAREN_nadp_RPAREN_m]]
 
* [[GDRh]]
 
* [[GDRm]]
 
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
* [[GLUTATHIONE-SYN-RXN]]
 
* [[GLYOXI-RXN]]
 
* [[GLYOXII-RXN]]
 
* [[GST-RXN]]
 
* [[RXN-13161]]
 
* [[RXN-7919]]
 
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glutathione}}
+
{{#set: common-name=glycyl-l-methionine}}
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}}
{{#set: molecular-weight=306.313}}
+
{{#set: molecular-weight=206.259}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-13393

  • common-name:
    • glycyl-l-methionine
  • smiles:
    • csccc(c(=o)[o-])nc(=o)c[n+]
  • inchi-key:
    • pfmuccyyaafkth-yfkpbyrvsa-n
  • molecular-weight:
    • 206.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality