Difference between revisions of "CPD-13393"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...")
(Created page with "Category:metabolite == Metabolite Guanine10-in-tRNA == * common-name: ** a guanine10 in trna == Reaction(s) known to consume the compound == * RXN-12374 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8090 ==
+
== Metabolite Guanine10-in-tRNA ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
+
** a guanine10 in trna
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** qfdyidgukxrpkh-vslglsmxsa-n
 
* molecular-weight:
 
** 780.076
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8331]]
+
* [[RXN-12374]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8323]]
 
* [[RXN-8330]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=a guanine10 in trna}}
{{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}}
 
{{#set: molecular-weight=780.076}}
 

Revision as of 14:55, 5 January 2021

Metabolite Guanine10-in-tRNA

  • common-name:
    • a guanine10 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality