|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ21933 == | + | == Metabolite CPD-13393 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** glycyl-l-methionine |
| − | * right-end-position:
| + | * smiles: |
| − | ** 93975
| + | ** csccc(c(=o)[o-])nc(=o)c[n+] |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 86901 | + | ** pfmuccyyaafkth-yfkpbyrvsa-n |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 47.36188
| + | ** 206.259 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN0-6974]] |
| − | == Reaction(s) associated ==
| + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[RXN-10606]]
| + | {{#set: common-name=glycyl-l-methionine}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=206.259}} |
| − | * [[RXN-10607]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10608]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10609]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10616]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10617]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10618]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10619]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10784]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-11060]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13607]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13608]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14361]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-9000]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN66-162]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN66-168]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN66-83]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[UDP-GLUCURONOSYLTRANSFERASE-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-6261]] | |
| − | ** '''10''' reactions found over '''15''' reactions in the full pathway
| |
| − | * [[PWY-6313]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6398]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5756]]
| |
| − | ** '''1''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY66-221]]
| |
| − | ** '''5''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY66-201]]
| |
| − | ** '''3''' reactions found over '''16''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=93975}} | |
| − | {{#set: left-end-position=86901}}
| |
| − | {{#set: centisome-position=47.36188 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=18}}
| |
| − | {{#set: nb pathway associated=6}}
| |
