|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ21121 == | + | == Metabolite CPD-13394 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** glycyl-l-glutamine |
| − | * right-end-position:
| + | * smiles: |
| − | ** 534078
| + | ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 525703
| + | ** pnmuaggsdzxthx-bypyzucnsa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 86.97917 | + | ** 203.197 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN0-6983]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[ADPREDUCT-RXN]]
| + | {{#set: common-name=glycyl-l-glutamine}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=pnmuaggsdzxthx-bypyzucnsa-n}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=203.197}} |
| − | * [[CDPREDUCT-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[GDPREDUCT-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN0-722]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-747]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-748]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[UDPREDUCT-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-7220]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7227]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY0-166]]
| |
| − | ** '''14''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7210]]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7198]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7184]]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6545]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7222]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7226]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=534078}} | |
| − | {{#set: left-end-position=525703}}
| |
| − | {{#set: centisome-position=86.97917 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=9}}
| |
| − | {{#set: nb pathway associated=9}}
| |
