Difference between revisions of "CPD-13394"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: ** coc1(=c(o)c=cc(c(o)c=o)=c1) * inchi-key: ** visajvapy...") |
(Created page with "Category:metabolite == Metabolite 2-KETO-GLUTARAMATE == * common-name: ** 2-oxoglutaramate * smiles: ** c(cc(n)=o)c(=o)c(=o)[o-] * inchi-key: ** cojbgnauusnxhx-uhfffaoysa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-KETO-GLUTARAMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-oxoglutaramate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc(n)=o)c(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cojbgnauusnxhx-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 144.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.6.1.64-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.6.1.64-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-oxoglutaramate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cojbgnauusnxhx-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=144.107}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite 2-KETO-GLUTARAMATE
- common-name:
- 2-oxoglutaramate
- smiles:
- c(cc(n)=o)c(=o)c(=o)[o-]
- inchi-key:
- cojbgnauusnxhx-uhfffaoysa-m
- molecular-weight:
- 144.107
