Difference between revisions of "CPD-13395"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-34 == * common-name: ** 1,2-dipalmitoylglycerol * smiles: ** cccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-key: ** jejlg...")
(Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-key: ** fuesbomyallfni-vkhmyheas...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-34 ==
+
== Metabolite CPD-13395 ==
 
* common-name:
 
* common-name:
** 1,2-dipalmitoylglycerol
+
** glycyl-l-asparagine
 
* smiles:
 
* smiles:
** cccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
+
** c([n+])c(=o)nc(cc(n)=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** jejlgiqlpyygee-xiffeerxsa-n
+
** fuesbomyallfni-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 568.919
+
** 189.171
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-578]]
+
* [[RXN0-6982]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHATIDATE-PHOSPHATASE-RXN-CPD0-1422/WATER//CPD66-34/Pi.29.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-dipalmitoylglycerol}}
+
{{#set: common-name=glycyl-l-asparagine}}
{{#set: inchi-key=inchikey=jejlgiqlpyygee-xiffeerxsa-n}}
+
{{#set: inchi-key=inchikey=fuesbomyallfni-vkhmyheasa-n}}
{{#set: molecular-weight=568.919}}
+
{{#set: molecular-weight=189.171}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-13395

  • common-name:
    • glycyl-l-asparagine
  • smiles:
    • c([n+])c(=o)nc(cc(n)=o)c([o-])=o
  • inchi-key:
    • fuesbomyallfni-vkhmyheasa-n
  • molecular-weight:
    • 189.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality