Difference between revisions of "CPD-13397"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12448 RXN-12448] == * direction: ** reversible * common-name: ** alcohol dehydrogenase ** alcoh...")
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12448 RXN-12448] ==
+
== Metabolite CPD-13397 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** alcohol dehydrogenase
+
** l-alanyl-l-threonine
−
** alcohol dehydrogenase (nad)
+
* smiles:
−
* ec-number:
+
** cc([n+])c(=o)nc(c(o)c)c([o-])=o
−
** [http://enzyme.expasy.org/EC/1.1.1.1 ec-1.1.1.1]
+
* inchi-key:
−
== Reaction formula ==
+
** buqichwnxbibog-lmvfsukvsa-n
−
* 1 [[NAD]][c] '''+''' 1 [[Secondary-Alcohols]][c] '''<=>''' 1 [[LONG-CHAIN-KETONE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 190.199
−
* Gene: [[SJ21601]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN0-6980]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ07759]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=l-alanyl-l-threonine}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}}
−
* Gene: [[SJ14768]]
+
{{#set: molecular-weight=190.199}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00624 R00624]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10743 10743]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=alcohol dehydrogenase (nad)|alcohol dehydrogenase}}
 
−
{{#set: ec-number=ec-1.1.1.1}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13397

  • common-name:
    • l-alanyl-l-threonine
  • smiles:
    • cc([n+])c(=o)nc(c(o)c)c([o-])=o
  • inchi-key:
    • buqichwnxbibog-lmvfsukvsa-n
  • molecular-weight:
    • 190.199

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13397&oldid=138888"