|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DALADALALIG-RXN DALADALALIG-RXN] == | + | == Metabolite CPD-13397 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** d-alanine-d-alanine ligase | + | ** l-alanyl-l-threonine |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.3.2.4 ec-6.3.2.4] | + | ** cc([n+])c(=o)nc(c(o)c)c([o-])=o |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 2 [[D-ALANINE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[D-ALA-D-ALA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
| + | ** buqichwnxbibog-lmvfsukvsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ17851]] | + | ** 190.199 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN0-6980]] |
| − | * Gene: [[SJ12670]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | {{#set: common-name=l-alanyl-l-threonine}} |
| − | * Gene: [[SJ02214]]
| + | {{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=190.199}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ12870]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ06726]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY-7953]], UDP-N-acetylmuramoyl-pentapeptide biosynthesis III (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7953 PWY-7953] | |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6386]], UDP-N-acetylmuramoyl-pentapeptide biosynthesis II (lysine-containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6386 PWY-6386]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6387]], UDP-N-acetylmuramoyl-pentapeptide biosynthesis I (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6387 PWY-6387]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11224 11224]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01150 R01150]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/O83676 O83676]
| |
| − | ** [http://www.uniprot.org/uniprot/O66806 O66806]
| |
| − | ** [http://www.uniprot.org/uniprot/P46805 P46805]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A1F0 P0A1F0]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A6J8 P0A6J8]
| |
| − | ** [http://www.uniprot.org/uniprot/P07862 P07862]
| |
| − | ** [http://www.uniprot.org/uniprot/P96612 P96612]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZDS6 Q9ZDS6]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CIL5 Q9CIL5]
| |
| − | ** [http://www.uniprot.org/uniprot/P44405 P44405]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PPC2 Q9PPC2]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JSZ9 Q9JSZ9]
| |
| − | ** [http://www.uniprot.org/uniprot/P35660 P35660]
| |
| − | ** [http://www.uniprot.org/uniprot/P73632 P73632]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9XAK7 Q9XAK7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RLE4 Q9RLE4]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=d-alanine-d-alanine ligase}} | |
| − | {{#set: ec-number=ec-6.3.2.4}} | |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
