Difference between revisions of "CPD-13397"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Poly-Gamma-Glutamylcysteine-Glycines == * common-name: ** a poly-[γ-glutamylcysteine]-glycine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13397 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-threonine |
| + | * smiles: | ||
| + | ** cc([n+])c(=o)nc(c(o)c)c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** buqichwnxbibog-lmvfsukvsa-n | ||
| + | * molecular-weight: | ||
| + | ** 190.199 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6980]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-threonine}} |
| + | {{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}} | ||
| + | {{#set: molecular-weight=190.199}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13397
- common-name:
- l-alanyl-l-threonine
- smiles:
- cc([n+])c(=o)nc(c(o)c)c([o-])=o
- inchi-key:
- buqichwnxbibog-lmvfsukvsa-n
- molecular-weight:
- 190.199
