Difference between revisions of "CPD-13397"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Poly-Gamma-Glutamylcysteine-Glycines == * common-name: ** a poly-[γ-glutamylcysteine]-glycine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROXYNAPHTHOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-carboxy-1,4-naphthoquinol |
| + | * smiles: | ||
| + | ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) | ||
| + | * inchi-key: | ||
| + | ** vojuxhhacrxltd-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 203.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NPHS]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-carboxy-1,4-naphthoquinol}} |
| + | {{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=203.174}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite DIHYDROXYNAPHTHOATE
- common-name:
- 2-carboxy-1,4-naphthoquinol
- smiles:
- c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
- inchi-key:
- vojuxhhacrxltd-uhfffaoysa-m
- molecular-weight:
- 203.174
