Difference between revisions of "CPD-13404"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13404 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-aspartate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xaewtdmgfghwfk-imjsidkusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6975]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-aspartate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.174}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-13404
- common-name:
- l-alanyl-l-aspartate
- smiles:
- cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
- inchi-key:
- xaewtdmgfghwfk-imjsidkusa-m
- molecular-weight:
- 203.174
