Difference between revisions of "CPD-13404"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...")
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8259 ==
+
== Metabolite CPD-13404 ==
 
* common-name:
 
* common-name:
** β-d-ribosylnicotinate
+
** l-alanyl-l-aspartate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
+
** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** pueddpcucprqny-zyuzmqfosa-n
+
** xaewtdmgfghwfk-imjsidkusa-m
 
* molecular-weight:
 
* molecular-weight:
** 255.227
+
** 203.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[RXN0-6975]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14227]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-ribosylnicotinate}}
+
{{#set: common-name=l-alanyl-l-aspartate}}
{{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}}
+
{{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}}
{{#set: molecular-weight=255.227}}
+
{{#set: molecular-weight=203.174}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-13404

  • common-name:
    • l-alanyl-l-aspartate
  • smiles:
    • cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
  • inchi-key:
    • xaewtdmgfghwfk-imjsidkusa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality