Difference between revisions of "CPD-13404"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05313 == * transcription-direction: ** positive * right-end-position: ** 36811 * left-end-position: ** 25668 * centisome-position: ** 27.256798...") |
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8259 == |
| − | * | + | * common-name: |
| − | ** | + | ** β-d-ribosylnicotinate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** pueddpcucprqny-zyuzmqfosa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 255.227 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8443]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-14227]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=β-d-ribosylnicotinate}} | |
| − | == | + | {{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}} |
| − | + | {{#set: molecular-weight=255.227}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-8259
- common-name:
- β-d-ribosylnicotinate
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
- inchi-key:
- pueddpcucprqny-zyuzmqfosa-n
- molecular-weight:
- 255.227
