Difference between revisions of "CPD-13406"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02300 == * transcription-direction: ** positive * right-end-position: ** 111195 * left-end-position: ** 77475 * centisome-position: ** 55.87247...")
(Created page with "Category:metabolite == Metabolite CPD-13406 == * common-name: ** glycyl-l-aspartate * smiles: ** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-] * inchi-key: ** sccpdjaqcxwptf-vkhmyhe...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02300 ==
+
== Metabolite CPD-13406 ==
* transcription-direction:
+
* common-name:
** positive
+
** glycyl-l-aspartate
* right-end-position:
+
* smiles:
** 111195
+
** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-]
* left-end-position:
+
* inchi-key:
** 77475
+
** sccpdjaqcxwptf-vkhmyheasa-m
* centisome-position:
+
* molecular-weight:
** 55.87247   
+
** 189.147
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-6987]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.6.12-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=glycyl-l-aspartate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=sccpdjaqcxwptf-vkhmyheasa-m}}
* [[ARYLSULFAT-RXN]]
+
{{#set: molecular-weight=189.147}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=111195}}
 
{{#set: left-end-position=77475}}
 
{{#set: centisome-position=55.87247    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-13406

  • common-name:
    • glycyl-l-aspartate
  • smiles:
    • c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-]
  • inchi-key:
    • sccpdjaqcxwptf-vkhmyheasa-m
  • molecular-weight:
    • 189.147

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality