Difference between revisions of "CPD-13473"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06814 == * transcription-direction: ** positive * right-end-position: ** 34550 * left-end-position: ** 28427 * centisome-position: ** 38.01621...")
(Created page with "Category:metabolite == Metabolite CPD-13473 == * common-name: ** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06814 ==
+
== Metabolite CPD-13473 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine
* right-end-position:
+
* smiles:
** 34550
+
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
* left-end-position:
+
* inchi-key:
** 28427
+
** dlgjwsvwtwewbj-zdlrkiohsa-m
* centisome-position:
+
* molecular-weight:
** 38.01621   
+
** 378.312
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16485]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-zdlrkiohsa-m}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=378.312}}
* [[PWY-7206]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=34550}}
 
{{#set: left-end-position=28427}}
 
{{#set: centisome-position=38.01621    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-13473

  • common-name:
    • 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine
  • smiles:
    • cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
  • inchi-key:
    • dlgjwsvwtwewbj-zdlrkiohsa-m
  • molecular-weight:
    • 378.312

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality