Difference between revisions of "CPD-13473"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7004 == * common-name: ** dihydrogeranylgeranyl chlorophyll a * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc...") |
(Created page with "Category:metabolite == Metabolite CPD-13473 == * common-name: ** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(o...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13473 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dlgjwsvwtwewbj-zdlrkiohsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 378.312 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16485]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dlgjwsvwtwewbj-zdlrkiohsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=378.312}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-13473
- common-name:
- 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- dlgjwsvwtwewbj-zdlrkiohsa-m
- molecular-weight:
- 378.312
