Difference between revisions of "CPD-13518"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22407 == * transcription-direction: ** positive * right-end-position: ** 115731 * left-end-position: ** 110896 * centisome-position: ** 62.623035...") |
(Created page with "Category:metabolite == Metabolite CPD-13518 == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+])ccc([n+])c([o-])=o * inchi-key: ** fqwravymzulpnk-b...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13518 == |
| − | * | + | * common-name: |
| − | ** | + | ** nω-hydroxy-l-arginine |
| − | * | + | * smiles: |
| − | ** | + | ** c(nc(no)=[n+])ccc([n+])c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** fqwravymzulpnk-bypyzucnsa-o |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 191.209 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13565]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-13564]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=nω-hydroxy-l-arginine}} | |
| − | == | + | {{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}} |
| − | + | {{#set: molecular-weight=191.209}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-13518
- common-name:
- nω-hydroxy-l-arginine
- smiles:
- c(nc(no)=[n+])ccc([n+])c([o-])=o
- inchi-key:
- fqwravymzulpnk-bypyzucnsa-o
- molecular-weight:
- 191.209
