Difference between revisions of "CPD-13524"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9868 == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite CPD-24184 == == Reaction(s) known to consume the compound == * RXN-22206 == Reaction(s) known to produce the compound == * RXN-2220...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9868 ==
+
== Metabolite CPD-24184 ==
* common-name:
 
** 3-(all-trans-nonaprenyl)benzene-1,2-diol
 
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** pkyzmvivzpjxfm-xbvqzqhusa-n
 
* molecular-weight:
 
** 723.176
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9240]]
+
* [[RXN-22206]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-22205 ]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}}
 
{{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}}
 
{{#set: molecular-weight=723.176}}
 

Revision as of 11:14, 15 January 2021

Metabolite CPD-24184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality