Difference between revisions of "CPD-13524"

Latest revision as of 11:13, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD0-2232 ==
+== Metabolite CPD-13524 ==
 * common-name:
-** (s)-3-hydroxyhexadecanoyl-coa
+** all-trans-retinol
 * smiles:
-** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 * inchi-key:
-** dehlmtddpwdrdr-qqojfmbssa-j
+** fpipgxgpppqfeq-ovsjkpmpsa-n
 * molecular-weight:
-** 1017.914
+** 286.456
 == Reaction(s) known to consume the compound ==
-* [[ECOAH7h]]
+* [[1.3.99.23-RXN]]
-* [[HACD7h]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
-* [[RXN-14271]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12547]]
 == Reaction(s) known to produce the compound ==
-* [[ECOAH7h]]
+* [[3.1.1.64-RXN]]
-* [[HACD7h]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
-* [[RXN-14271]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
-* [[RXN-14272]]
+* [[RXN-10841]]
+* [[RXN-12575]]
+* [[RXN-12579]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxyhexadecanoyl-coa}}
+{{#set: common-name=all-trans-retinol}}
-{{#set: inchi-key=inchikey=dehlmtddpwdrdr-qqojfmbssa-j}}
+{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
-{{#set: molecular-weight=1017.914}}
+{{#set: molecular-weight=286.456}}