|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ03090 == | + | == Metabolite CPD-13524 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** all-trans-retinol |
| − | * right-end-position:
| + | * smiles: |
| − | ** 26212
| + | ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 24068 | + | ** fpipgxgpppqfeq-ovsjkpmpsa-n |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 19.211521
| + | ** 286.456 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[1.3.99.23-RXN]] |
| − | == Reaction(s) associated == | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
| − | * [[ACYLCOADEHYDROG-RXN]] | + | * [[RXN-10841]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-12547]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
| + | * [[3.1.1.64-RXN]] |
| − | ** Category: [[annotation]]
| + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
| − | * [[RXN-10696]] | + | * [[RXN-10841]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-12575]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | * [[RXN-12579]] |
| − | * [[RXN-10706]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]] | + | {{#set: common-name=all-trans-retinol}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}} |
| − | * [[RXN-10707]]
| + | {{#set: molecular-weight=286.456}} |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-11026]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-12518]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-12669]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14576]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14771]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14775]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14785]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14789]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14796]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-16134]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-17113]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[FAO-PWY]] | |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-735]] | |
| − | ** '''16''' reactions found over '''19''' reactions in the full pathway
| |
| − | * [[PWY-7007]]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7288]] | |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5136]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY66-391]]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6837]]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6920]] | |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7291]] | |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7337]] | |
| − | ** '''6''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7338]]
| |
| − | ** '''6''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7340]]
| |
| − | ** '''5''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-7606]]
| |
| − | ** '''8''' reactions found over '''14''' reactions in the full pathway
| |
| − | * [[PWY-7726]]
| |
| − | ** '''8''' reactions found over '''13''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=26212}} | |
| − | {{#set: left-end-position=24068}}
| |
| − | {{#set: centisome-position=19.211521 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=16}}
| |
| − | {{#set: nb pathway associated=14}}
| |
