Difference between revisions of "CPD-13524"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14687 == * transcription-direction: ** negative * right-end-position: ** 5864 * left-end-position: ** 861 * centisome-position: ** 0.27720183 =...") |
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13524 == |
| − | * | + | * common-name: |
| − | ** | + | ** all-trans-retinol |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** fpipgxgpppqfeq-ovsjkpmpsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 286.456 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[1.3.99.23-RXN]] |
| − | == Reaction(s) | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | * [[ | + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
| − | * | + | * [[RXN-10841]] |
| − | * | + | * [[RXN-12547]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[3.1.1.64-RXN]] |
| − | + | * [[RETINOL-DEHYDROGENASE-RXN]] | |
| − | {{#set: | + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
| − | {{#set: | + | * [[RXN-10841]] |
| − | + | * [[RXN-12575]] | |
| + | * [[RXN-12579]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=all-trans-retinol}} | ||
| + | {{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}} | ||
| + | {{#set: molecular-weight=286.456}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-13524
- common-name:
- all-trans-retinol
- smiles:
- cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
- inchi-key:
- fpipgxgpppqfeq-ovsjkpmpsa-n
- molecular-weight:
- 286.456
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3.1.1.64-RXN
- RETINOL-DEHYDROGENASE-RXN
- RETINOL-O-FATTY-ACYLTRANSFERASE-RXN
- RXN-10841
- RXN-12575
- RXN-12579
