Difference between revisions of "CPD-13524"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02934 == * transcription-direction: ** negative * right-end-position: ** 126484 * left-end-position: ** 124355 * centisome-position: ** 97.64975...")
 
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02934 ==
+
== Metabolite CPD-13524 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** all-trans-retinol
−
* right-end-position:
+
* smiles:
−
** 126484
+
** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
−
* left-end-position:
+
* inchi-key:
−
** 124355
+
** fpipgxgpppqfeq-ovsjkpmpsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 97.64975   
+
** 286.456
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.3.99.23-RXN]]
−
== Reaction(s) associated ==
+
* [[RETINOL-DEHYDROGENASE-RXN]]
−
* [[RXN-15117]]
+
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-10841]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12547]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-5472]]
+
* [[3.1.1.64-RXN]]
−
** Category: [[annotation]]
+
* [[RETINOL-DEHYDROGENASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-10841]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12575]]
−
== Pathway(s) associated ==
+
* [[RXN-12579]]
−
* [[PWY-7817]]
+
== Reaction(s) of unknown directionality ==
−
** '''6''' reactions found over '''16''' reactions in the full pathway
+
{{#set: common-name=all-trans-retinol}}
−
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
+
{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
−
** '''16''' reactions found over '''19''' reactions in the full pathway
+
{{#set: molecular-weight=286.456}}
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=126484}}
 
−
{{#set: left-end-position=124355}}
 
−
{{#set: centisome-position=97.64975    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-13524

  • common-name:
    • all-trans-retinol
  • smiles:
    • cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
  • inchi-key:
    • fpipgxgpppqfeq-ovsjkpmpsa-n
  • molecular-weight:
    • 286.456

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13524&oldid=137575"