Difference between revisions of "CPD-13524"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-GlcNAc-alpha-D-mannosyl-L-Thr == * common-name: ** o2-[n-acetyl-β-d-glucosaminyl-(1→4)-α-d-mannosy]-l-threonyl-[p...") |
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CINNAMOYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** (e)-cinnamoyl-coa |
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** jvnvhnhitfvwix-kzkudurgsa-j | ||
| + | * molecular-weight: | ||
| + | ** 893.648 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7645]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-2001]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(e)-cinnamoyl-coa}} |
| + | {{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}} | ||
| + | {{#set: molecular-weight=893.648}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite CINNAMOYL-COA
- common-name:
- (e)-cinnamoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- jvnvhnhitfvwix-kzkudurgsa-j
- molecular-weight:
- 893.648
