Difference between revisions of "CPD-13533"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Nonmethylated-Ribosomal-Protein-L11s == * common-name: ** a non-methylated ribosomal protein l11 == Reaction(s) known to consume the comp...") |
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4211 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dimethylallyl diphosphate |
| + | * smiles: | ||
| + | ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** cbidrcwhncksto-uhfffaoysa-k | ||
| + | * molecular-weight: | ||
| + | ** 243.069 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN0- | + | * [[GPPS]] |
| + | * [[GPPSYN-RXN]] | ||
| + | * [[IPPISOM-RXN]] | ||
| + | * [[RXN-4303]] | ||
| + | * [[RXN-4305]] | ||
| + | * [[RXN-4307]] | ||
| + | * [[RXN-7810]] | ||
| + | * [[RXN-7811]] | ||
| + | * [[RXN-7813]] | ||
| + | * [[RXN0-6274]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GPPSYN-RXN]] | ||
| + | * [[IDI]] | ||
| + | * [[IDS2]] | ||
| + | * [[IPPISOM-RXN]] | ||
| + | * [[RXN0-884]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dimethylallyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=243.069}} | ||
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-4211
- common-name:
- dimethylallyl diphosphate
- smiles:
- cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- cbidrcwhncksto-uhfffaoysa-k
- molecular-weight:
- 243.069
