Difference between revisions of "CPD-13559"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) * inchi-key: ** nzkryjgnypyxjz-u...") |
(Created page with "Category:metabolite == Metabolite CPD-13559 == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-pqmkyfcfsa-...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13559 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-mannopyranose |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c(o)c1(c(o)c(o)c(o)c(o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqzgkkkjijffok-pqmkyfcfsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.24-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-mannopyranose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-pqmkyfcfsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-13559
- common-name:
- α-d-mannopyranose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- wqzgkkkjijffok-pqmkyfcfsa-n
- molecular-weight:
- 180.157
