Difference between revisions of "CPD-13575"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...") |
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13575 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate |
| + | * smiles: | ||
| + | ** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1) | ||
| + | * inchi-key: | ||
| + | ** pqmcqnovnfnpfj-hyimlasbsa-k | ||
| + | * molecular-weight: | ||
| + | ** 264.169 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12611]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[THIAZOLSYN2-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}} |
| + | {{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}} | ||
| + | {{#set: molecular-weight=264.169}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-13575
- common-name:
- 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
- smiles:
- cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
- inchi-key:
- pqmcqnovnfnpfj-hyimlasbsa-k
- molecular-weight:
- 264.169
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
