Difference between revisions of "CPD-13576"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15651 == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite ANDROST4ENE == * common-name: ** androst-4-ene-3,17-dione * smiles: ** cc34(ccc(=o)c=c(cc[ch]1([ch](ccc2(c)(c(cc[ch]12)=o))3))4) * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15651 ==
+
== Metabolite ANDROST4ENE ==
 
* common-name:
 
* common-name:
** 6-trans-tridecenoyl-coa
+
** androst-4-ene-3,17-dione
 
* smiles:
 
* smiles:
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc34(ccc(=o)c=c(cc[ch]1([ch](ccc2(c)(c(cc[ch]12)=o))3))4)
 
* inchi-key:
 
* inchi-key:
** uuivzebypbpkll-hmxwsvnbsa-j
+
** aemfnilzojdqlw-qaggrknesa-n
 
* molecular-weight:
 
* molecular-weight:
** 957.819
+
** 286.413
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14785]]
+
* [[1.1.1.64-RXN]]
 +
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.1.51-RXN]]
 +
* [[RXN-12124]]
 +
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-trans-tridecenoyl-coa}}
+
{{#set: common-name=androst-4-ene-3,17-dione}}
{{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}}
+
{{#set: inchi-key=inchikey=aemfnilzojdqlw-qaggrknesa-n}}
{{#set: molecular-weight=957.819}}
+
{{#set: molecular-weight=286.413}}

Revision as of 15:26, 5 January 2021

Metabolite ANDROST4ENE

  • common-name:
    • androst-4-ene-3,17-dione
  • smiles:
    • cc34(ccc(=o)c=c(cc[ch]1([ch](ccc2(c)(c(cc[ch]12)=o))3))4)
  • inchi-key:
    • aemfnilzojdqlw-qaggrknesa-n
  • molecular-weight:
    • 286.413

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality