Difference between revisions of "CPD-13610"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-464 == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-...")
(Created page with "Category:metabolite == Metabolite CADAVERINE == * common-name: ** cadaverine * smiles: ** c([n+])cccc[n+] * inchi-key: ** vhrgrcvqafmjiz-uhfffaoysa-p * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-464 ==
+
== Metabolite CADAVERINE ==
 
* common-name:
 
* common-name:
** prephytoene diphosphate
+
** cadaverine
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
+
** c([n+])cccc[n+]
 
* inchi-key:
 
* inchi-key:
** rvcnktpchznaao-imslgmfesa-k
+
** vhrgrcvqafmjiz-uhfffaoysa-p
 
* molecular-weight:
 
* molecular-weight:
** 719.897
+
** 104.195
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNARA-8002]]
+
* [[RXN0-5217]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.32-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prephytoene diphosphate}}
+
{{#set: common-name=cadaverine}}
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
+
{{#set: inchi-key=inchikey=vhrgrcvqafmjiz-uhfffaoysa-p}}
{{#set: molecular-weight=719.897}}
+
{{#set: molecular-weight=104.195}}

Revision as of 18:53, 14 January 2021

Metabolite CADAVERINE

  • common-name:
    • cadaverine
  • smiles:
    • c([n+])cccc[n+]
  • inchi-key:
    • vhrgrcvqafmjiz-uhfffaoysa-p
  • molecular-weight:
    • 104.195

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality