Difference between revisions of "CPD-13611"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12127 == * common-name: ** menaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(...")
(Created page with "Category:metabolite == Metabolite CPD-13611 == * common-name: ** sphinganine (c20) * smiles: ** cccccccccccccccccc(o)c([n+])co * inchi-key: ** ufmhybvqzspwss-vqtjnvassa-o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12127 ==
+
== Metabolite CPD-13611 ==
 
* common-name:
 
* common-name:
** menaquinol-10
+
** sphinganine (c20)
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
+
** cccccccccccccccccc(o)c([n+])co
 
* inchi-key:
 
* inchi-key:
** wlkiromwgyxjma-uqunhumxsa-n
+
** ufmhybvqzspwss-vqtjnvassa-o
 
* molecular-weight:
 
* molecular-weight:
** 855.381
+
** 330.573
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12642]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9361]]
+
* [[RXN-12642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-10}}
+
{{#set: common-name=sphinganine (c20)}}
{{#set: inchi-key=inchikey=wlkiromwgyxjma-uqunhumxsa-n}}
+
{{#set: inchi-key=inchikey=ufmhybvqzspwss-vqtjnvassa-o}}
{{#set: molecular-weight=855.381}}
+
{{#set: molecular-weight=330.573}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13611

  • common-name:
    • sphinganine (c20)
  • smiles:
    • cccccccccccccccccc(o)c([n+])co
  • inchi-key:
    • ufmhybvqzspwss-vqtjnvassa-o
  • molecular-weight:
    • 330.573

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality