Difference between revisions of "CPD-13611"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...") |
(Created page with "Category:metabolite == Metabolite CPD-13611 == * common-name: ** sphinganine (c20) * smiles: ** cccccccccccccccccc(o)c([n+])co * inchi-key: ** ufmhybvqzspwss-vqtjnvassa-o...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13611 == |
* common-name: | * common-name: | ||
| − | ** | + | ** sphinganine (c20) |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccc(o)c([n+])co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufmhybvqzspwss-vqtjnvassa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 330.573 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-12642]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12642]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sphinganine (c20)}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufmhybvqzspwss-vqtjnvassa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=330.573}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13611
- common-name:
- sphinganine (c20)
- smiles:
- cccccccccccccccccc(o)c([n+])co
- inchi-key:
- ufmhybvqzspwss-vqtjnvassa-o
- molecular-weight:
- 330.573
