Difference between revisions of "CPD-13611"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.170-RXN 1.1.1.170-RXN] == * direction: ** reversible * common-name: ** 3β-hydroxy-4&beta...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.170-RXN 1.1.1.170-RXN] ==
+
== Metabolite L-ORNITHINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate 3-dehydrogenase, decarboxylating
+
** l-ornithine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.170 ec-1.1.1.170]
+
** c(=o)([o-])c([n+])ccc[n+]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-5846]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''<=>''' 1 [[4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
+
** ahlphdhhmvztml-bypyzucnsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04782]]
+
** 133.17
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ACETYLORNDEACET-RXN]]
−
== Pathway(s) ==
+
* [[ARGINASE-RXN]]
−
== Reconstruction information  ==
+
* [[ORDC]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ORNCARBAMTRANSFER-RXN]]
−
== External links  ==
+
* [[ORNDECARBOX-RXN]]
−
* RHEA:
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20676 20676]
+
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20672 20672]
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
* LIGAND-RXN:
+
* [[RXN-13482]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R07149 R07149]
+
* [[biomass_rxn]]
−
{{#set: direction=reversible}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: common-name=3&beta;-hydroxy-4&beta;-methyl-5&alpha;-cholest-7-ene-4&alpha;-carboxylate 3-dehydrogenase, decarboxylating}}
+
* [[ACETYLORNDEACET-RXN]]
−
{{#set: ec-number=ec-1.1.1.170}}
+
* [[AODAA]]
−
{{#set: nb gene associated=1}}
+
* [[ARGINASE-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
−
{{#set: reconstruction category=annotation}}
+
* [[ORNCARBAMTRANSFER-RXN]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
−
{{#set: reconstruction comment=n.a}}
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-13482]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-ornithine}}
 +
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
 +
{{#set: molecular-weight=133.17}}

Revision as of 20:36, 18 December 2020

Metabolite L-ORNITHINE

  • common-name:
    • l-ornithine
  • smiles:
    • c(=o)([o-])c([n+])ccc[n+]
  • inchi-key:
    • ahlphdhhmvztml-bypyzucnsa-o
  • molecular-weight:
    • 133.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13611&oldid=47789"