Difference between revisions of "CPD-13611"

Revision as of 14:58, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-ORNITHINE ==
+== Metabolite D-glucopyranose-6-phosphate ==
 * common-name:
-** l-ornithine
+** d-glucopyranose 6-phosphate
-* smiles:
-** c(=o)([o-])c([n+])ccc[n+]
-* inchi-key:
-** ahlphdhhmvztml-bypyzucnsa-o
-* molecular-weight:
-** 133.17
 == Reaction(s) known to consume the compound ==
-* [[ACETYLORNDEACET-RXN]]
+* [[GLU6PDEHYDROG-RXN]]
-* [[ARGINASE-RXN]]
+* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
-* [[ORDC]]
+* [[PGLUCISOM-RXN]]
-* [[ORNCARBAMTRANSFER-RXN]]
+* [[PHOSPHOGLUCMUT-RXN]]
-* [[ORNDECARBOX-RXN]]
+* [[RXN-14819]]
-* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[RXN66-526]]
-* [[ORNITHINE-CYCLODEAMINASE-RXN]]
+* [[TREHALOSE6PSYN-RXN]]
-* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
-* [[RXN-13482]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ACETYLORNDEACET-RXN]]
+* [[GLUCOKIN-RXN]]
-* [[AODAA]]
+* [[PGLUCISOM-RXN]]
-* [[ARGINASE-RXN]]
+* [[PHOSPHOGLUCMUT-RXN]]
-* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+* [[RXN-14819]]
-* [[ORNCARBAMTRANSFER-RXN]]
+* [[RXN-16998]]
-* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
-* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
-* [[RXN-13482]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-ornithine}}
+{{#set: common-name=d-glucopyranose 6-phosphate}}
-{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
-{{#set: molecular-weight=133.17}}