Difference between revisions of "CPD-13612"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11673 == * common-name: ** 5-hydroxytryptophol glucuronide * smiles: ** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3)) * in...") |
(Created page with "Category:metabolite == Metabolite CPD-13612 == * common-name: ** d-erythro-sphinganine * smiles: ** cccccccccccccccc(c(co)[n+])o * inchi-key: ** otkjdmgtuttymp-zwkotpchsa-...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13612 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-erythro-sphinganine |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc(c(co)[n+])o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** otkjdmgtuttymp-zwkotpchsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 302.519 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SPHINGANINE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-erythro-sphinganine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=otkjdmgtuttymp-zwkotpchsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=302.519}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13612
- common-name:
- d-erythro-sphinganine
- smiles:
- cccccccccccccccc(c(co)[n+])o
- inchi-key:
- otkjdmgtuttymp-zwkotpchsa-o
- molecular-weight:
- 302.519
