Difference between revisions of "CPD-13613"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11400 == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=...")
(Created page with "Category:metabolite == Metabolite CPD-13613 == * common-name: ** l-threo-sphinganine * smiles: ** cccccccccccccccc(c(co)[n+])o * inchi-key: ** otkjdmgtuttymp-rouuacijsa-o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11400 ==
+
== Metabolite CPD-13613 ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
+
** l-threo-sphinganine
 
* smiles:
 
* smiles:
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+
** cccccccccccccccc(c(co)[n+])o
 
* inchi-key:
 
* inchi-key:
** yyfgggcinngole-zdxogfqlsa-m
+
** otkjdmgtuttymp-rouuacijsa-o
 
* molecular-weight:
 
* molecular-weight:
** 826.095
+
** 302.519
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12645]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10607]]
+
* [[RXN-12645]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
+
{{#set: common-name=l-threo-sphinganine}}
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
+
{{#set: inchi-key=inchikey=otkjdmgtuttymp-rouuacijsa-o}}
{{#set: molecular-weight=826.095}}
+
{{#set: molecular-weight=302.519}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-13613

  • common-name:
    • l-threo-sphinganine
  • smiles:
    • cccccccccccccccc(c(co)[n+])o
  • inchi-key:
    • otkjdmgtuttymp-rouuacijsa-o
  • molecular-weight:
    • 302.519

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality