Difference between revisions of "CPD-13613"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-13613 == * common-name: ** l-threo-sphinganine * smiles: ** cccccccccccccccc(c(co)[n+])o * inchi-key: ** otkjdmgtuttymp-rouuacijsa-o...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13613 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-threo-sphinganine |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** cccccccccccccccc(c(co)[n+])o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** otkjdmgtuttymp-rouuacijsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 302.519 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-12645]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12645]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-threo-sphinganine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=otkjdmgtuttymp-rouuacijsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=302.519}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-13613
- common-name:
- l-threo-sphinganine
- smiles:
- cccccccccccccccc(c(co)[n+])o
- inchi-key:
- otkjdmgtuttymp-rouuacijsa-o
- molecular-weight:
- 302.519
