Difference between revisions of "CPD-13613"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UGD-RXN UGD-RXN] == * direction: ** left-to-right * common-name: ** udp-glucose 6-dehydrogenase * e...")
(Created page with "Category:metabolite == Metabolite CPD-11400 == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UGD-RXN UGD-RXN] ==
+
== Metabolite CPD-11400 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** udp-glucose 6-dehydrogenase
+
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.22 ec-1.1.1.22]
+
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-12575]][c] '''+''' 2 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[NADH]][c] '''+''' 3 [[PROTON]][c] '''+''' 1 [[UDP-GLUCURONATE]][c]
+
** yyfgggcinngole-zdxogfqlsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ16894]]
+
** 826.095
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-10607]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
* Gene: [[SJ03911]]
+
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
** Category: [[annotation]]
+
{{#set: molecular-weight=826.095}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ11024]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ11033]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ11025]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY-7346]], UDP-α-D-glucuronate biosynthesis (from UDP-glucose): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7346 PWY-7346]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
* [[PWY-7820]], teichuronic acid biosynthesis (B. subtilis 168): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7820 PWY-7820]
 
** '''2''' reactions found over '''9''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23597 23597]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00286 R00286]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q8NKX0 Q8NKX0]
 
** [http://www.uniprot.org/uniprot/Q9PML6 Q9PML6]
 
** [http://www.uniprot.org/uniprot/Q58454 Q58454]
 
** [http://www.uniprot.org/uniprot/Q47329 Q47329]
 
** [http://www.uniprot.org/uniprot/Q96558 Q96558]
 
** [http://www.uniprot.org/uniprot/O41091 O41091]
 
** [http://www.uniprot.org/uniprot/Q9RMC2 Q9RMC2]
 
** [http://www.uniprot.org/uniprot/O54068 O54068]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=udp-glucose 6-dehydrogenase}}
 
{{#set: ec-number=ec-1.1.1.22}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-11400

  • common-name:
    • 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
  • smiles:
    • c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
  • inchi-key:
    • yyfgggcinngole-zdxogfqlsa-m
  • molecular-weight:
    • 826.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality