Difference between revisions of "CPD-13613"

Revision as of 14:59, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11400 ==
+== Metabolite PHENYL-PYRUVATE ==
 * common-name:
-** 3,5,3'-triiodo-l-thyronine phenolic &beta;-d-glucuronide
+** keto-phenylpyruvate
 * smiles:
-** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
 * inchi-key:
-** yyfgggcinngole-zdxogfqlsa-m
+** btnmpgbkdvtsjy-uhfffaoysa-m
 * molecular-weight:
-** 826.095
+** 163.152
 == Reaction(s) known to consume the compound ==
+* [[2.6.1.64-RXN]]
+* [[PHEAMINOTRANS-RXN]]
+* [[PREPHENATEDEHYDRAT-RXN]]
+* [[RXN-10814]]
+* [[RXN-10815]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10607]]
+* [[2.6.1.64-RXN]]
+* [[PHEAMINOTRANS-RXN]]
+* [[PPDH]]
+* [[PREPHENATEDEHYDRAT-RXN]]
+* [[RXN-10814]]
+* [[RXN-17130]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic &beta;-d-glucuronide}}
+{{#set: common-name=keto-phenylpyruvate}}
-{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
+{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
-{{#set: molecular-weight=826.095}}
+{{#set: molecular-weight=163.152}}